C16H15ClF2N4O2 — CID 19290083
[(Z)-[amino(phenyl)methylidene]amino] 2-[4-chloro-5-cyclopropyl-3-(difluoromethyl)pyrazol-1-yl]acetate (PubChem CID 19290083) has the molecular formula C16H15ClF2N4O2 and a molecular weight of 368.77 g/mol. Its IUPAC name is [(Z)-[amino(phenyl)methylidene]amino] 2-[4-chloro-5-cyclopropyl-3-(difluoromethyl)pyrazol-1-yl]acetate.
| Compound Name | [(Z)-[amino(phenyl)methylidene]amino] 2-[4-chloro-5-cyclopropyl-3-(difluoromethyl)pyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 19290083 |
| Molecular Formula | C16H15ClF2N4O2 |
| Molecular Weight | 368.77 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | [(Z)-[amino(phenyl)methylidene]amino] 2-[4-chloro-5-cyclopropyl-3-(difluoromethyl)pyrazol-1-yl]acetate |
| SMILES | N/C(=N\OC(=O)Cn1nc(C(F)F)c(Cl)c1C1CC1)c1ccccc1 |
| InChI | InChI=1S/C16H15ClF2N4O2/c17-12-13(15(18)19)21-23(14(12)9-6-7-9)8-11(24)25-22-16(20)10-4-2-1-3-5-10/h1-5,9,15H,6-8H2,(H2,20,22) |
| InChIKey | YRQMPPRGQJHVRB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.77 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|