About [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 3-(3,5-dimethylpyrazol-1-yl)propanoate
[(Z)-[amino-(4-fluorophenyl)methylidene]amino] 3-(3,5-dimethylpyrazol-1-yl)propanoate (PubChem CID 19291852) has the molecular formula C15H17FN4O2
and a molecular weight of 304.33 g/mol. Its IUPAC name is [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 3-(3,5-dimethylpyrazol-1-yl)propanoate.
Molecular Properties
| Compound Name | [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 3-(3,5-dimethylpyrazol-1-yl)propanoate |
| PubChem CID | 19291852 |
| Molecular Formula | C15H17FN4O2 |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 3-(3,5-dimethylpyrazol-1-yl)propanoate |
| SMILES | Cc1cc(C)n(CCC(=O)O/N=C(\N)c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C15H17FN4O2/c1-10-9-11(2)20(18-10)8-7-14(21)22-19-15(17)12-3-5-13(16)6-4-12/h3-6,9H,7-8H2,1-2H3,(H2,17,19) |
| InChIKey | JDRRDLDRWRIXPL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 3-(3,5-dimethylpyrazol-1-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 3-(3,5-dimethylpyrazol-1-yl)propanoate?
The IUPAC name of [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 3-(3,5-dimethylpyrazol-1-yl)propanoate (CID 19291852) is [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 3-(3,5-dimethylpyrazol-1-yl)propanoate.
What is the SMILES notation for [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 3-(3,5-dimethylpyrazol-1-yl)propanoate?
The canonical SMILES for [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 3-(3,5-dimethylpyrazol-1-yl)propanoate is Cc1cc(C)n(CCC(=O)O/N=C(\N)c2ccc(F)cc2)n1.
What is the InChIKey of [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 3-(3,5-dimethylpyrazol-1-yl)propanoate?
The InChIKey is JDRRDLDRWRIXPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17FN4O2/c1-10-9-11(2)20(18-10)8-7-14(21)22-19-15(17)12-3-5-13(16)6-4-12/h3-6,9H,7-8H2,1-2H3,(H2,17,19).
What are the key properties of [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 3-(3,5-dimethylpyrazol-1-yl)propanoate?
[(Z)-[amino-(4-fluorophenyl)methylidene]amino] 3-(3,5-dimethylpyrazol-1-yl)propanoate has a molecular weight of 304.33 g/mol, XLogP of 1.89, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 3-(3,5-dimethylpyrazol-1-yl)propanoate is sourced from PubChem (CID 19291852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).