About [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2-(difluoromethoxy)benzoate
[(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2-(difluoromethoxy)benzoate (PubChem CID 19292177) has the molecular formula C15H10Cl2F2N2O3
and a molecular weight of 375.16 g/mol. Its IUPAC name is [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2-(difluoromethoxy)benzoate.
Molecular Properties
| Compound Name | [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2-(difluoromethoxy)benzoate |
| PubChem CID | 19292177 |
| Molecular Formula | C15H10Cl2F2N2O3 |
| Molecular Weight | 375.16 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2-(difluoromethoxy)benzoate |
| SMILES | N/C(=N\OC(=O)c1ccccc1OC(F)F)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H10Cl2F2N2O3/c16-8-5-6-9(11(17)7-8)13(20)21-24-14(22)10-3-1-2-4-12(10)23-15(18)19/h1-7,15H,(H2,20,21) |
| InChIKey | KDFGRZVSJHGAOB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.16 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2-(difluoromethoxy)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2-(difluoromethoxy)benzoate?
The IUPAC name of [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2-(difluoromethoxy)benzoate (CID 19292177) is [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2-(difluoromethoxy)benzoate.
What is the SMILES notation for [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2-(difluoromethoxy)benzoate?
The canonical SMILES for [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2-(difluoromethoxy)benzoate is N/C(=N\OC(=O)c1ccccc1OC(F)F)c1ccc(Cl)cc1Cl.
What is the InChIKey of [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2-(difluoromethoxy)benzoate?
The InChIKey is KDFGRZVSJHGAOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10Cl2F2N2O3/c16-8-5-6-9(11(17)7-8)13(20)21-24-14(22)10-3-1-2-4-12(10)23-15(18)19/h1-7,15H,(H2,20,21).
What are the key properties of [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2-(difluoromethoxy)benzoate?
[(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2-(difluoromethoxy)benzoate has a molecular weight of 375.16 g/mol, XLogP of 4.07, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2-(difluoromethoxy)benzoate is sourced from PubChem (CID 19292177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).