C17H23N3O3 — CID 19293707
N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3,5-dimethoxybenzamide (PubChem CID 19293707) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 19293707 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NCCCn2nc(C)cc2C)c1 |
| InChI | InChI=1S/C17H23N3O3/c1-12-8-13(2)20(19-12)7-5-6-18-17(21)14-9-15(22-3)11-16(10-14)23-4/h8-11H,5-7H2,1-4H3,(H,18,21) |
| InChIKey | PMVWPEPCNNWPSR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|