C13H12F3N5O2 — CID 19294001
[(Z)-[amino-(3-amino-2-methylphenyl)methylidene]amino] 5-(trifluoromethyl)-1H-pyrazole-3-carboxylate (PubChem CID 19294001) has the molecular formula C13H12F3N5O2 and a molecular weight of 327.27 g/mol. Its IUPAC name is [(Z)-[amino-(3-amino-2-methylphenyl)methylidene]amino] 5-(trifluoromethyl)-1H-pyrazole-3-carboxylate.
| Compound Name | [(Z)-[amino-(3-amino-2-methylphenyl)methylidene]amino] 5-(trifluoromethyl)-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 19294001 |
| Molecular Formula | C13H12F3N5O2 |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | [(Z)-[amino-(3-amino-2-methylphenyl)methylidene]amino] 5-(trifluoromethyl)-1H-pyrazole-3-carboxylate |
| SMILES | Cc1c(N)cccc1/C(N)=N/OC(=O)c1cc(C(F)(F)F)[nH]n1 |
| InChI | InChI=1S/C13H12F3N5O2/c1-6-7(3-2-4-8(6)17)11(18)21-23-12(22)9-5-10(20-19-9)13(14,15)16/h2-5H,17H2,1H3,(H2,18,21)(H,19,20) |
| InChIKey | JTZSOMGDDLSKQZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|