C20H26N4O3 — CID 19294159
[(Z)-[amino-(3-amino-2-methylphenyl)methylidene]amino] 5-tert-butyl-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxylate (PubChem CID 19294159) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is [(Z)-[amino-(3-amino-2-methylphenyl)methylidene]amino] 5-tert-butyl-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxylate.
| Compound Name | [(Z)-[amino-(3-amino-2-methylphenyl)methylidene]amino] 5-tert-butyl-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxylate |
|---|---|
| PubChem CID | 19294159 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | [(Z)-[amino-(3-amino-2-methylphenyl)methylidene]amino] 5-tert-butyl-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxylate |
| SMILES | Cc1c(N)cccc1/C(N)=N/OC(=O)c1noc2c1CC(C(C)(C)C)CC2 |
| InChI | InChI=1S/C20H26N4O3/c1-11-13(6-5-7-15(11)21)18(22)24-27-19(25)17-14-10-12(20(2,3)4)8-9-16(14)26-23-17/h5-7,12H,8-10,21H2,1-4H3,(H2,22,24) |
| InChIKey | FXOMLFHODKDSLU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|