C10H10F7N3O — CID 19294300
N-[(2,5-dimethylpyrazol-3-yl)methyl]-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 19294300) has the molecular formula C10H10F7N3O and a molecular weight of 321.20 g/mol. Its IUPAC name is N-[(2,5-dimethylpyrazol-3-yl)methyl]-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-[(2,5-dimethylpyrazol-3-yl)methyl]-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 19294300 |
| Molecular Formula | C10H10F7N3O |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | N-[(2,5-dimethylpyrazol-3-yl)methyl]-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | Cc1cc(CNC(=O)C(F)(F)C(F)(F)C(F)(F)F)n(C)n1 |
| InChI | InChI=1S/C10H10F7N3O/c1-5-3-6(20(2)19-5)4-18-7(21)8(11,12)9(13,14)10(15,16)17/h3H,4H2,1-2H3,(H,18,21) |
| InChIKey | NSOYJXVNLMCEGQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|