C18H17Cl2N3O3 — CID 19296693
N-[(4-chloro-1-ethylpyrazol-5-yl)methyl]-5-[(3-chlorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19296693) has the molecular formula C18H17Cl2N3O3 and a molecular weight of 394.26 g/mol. Its IUPAC name is N-[(4-chloro-1-ethylpyrazol-5-yl)methyl]-5-[(3-chlorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[(4-chloro-1-ethylpyrazol-5-yl)methyl]-5-[(3-chlorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19296693 |
| Molecular Formula | C18H17Cl2N3O3 |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | N-[(4-chloro-1-ethylpyrazol-5-yl)methyl]-5-[(3-chlorophenoxy)methyl]furan-2-carboxamide |
| SMILES | CCn1ncc(Cl)c1CNC(=O)c1ccc(COc2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C18H17Cl2N3O3/c1-2-23-16(15(20)9-22-23)10-21-18(24)17-7-6-14(26-17)11-25-13-5-3-4-12(19)8-13/h3-9H,2,10-11H2,1H3,(H,21,24) |
| InChIKey | FAMDSFMFEBZBPZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |