C10H9ClF7N3O — CID 19296795
N-[(4-chloro-1-ethylpyrazol-5-yl)methyl]-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 19296795) has the molecular formula C10H9ClF7N3O and a molecular weight of 355.64 g/mol. Its IUPAC name is N-[(4-chloro-1-ethylpyrazol-5-yl)methyl]-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-[(4-chloro-1-ethylpyrazol-5-yl)methyl]-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 19296795 |
| Molecular Formula | C10H9ClF7N3O |
| Molecular Weight | 355.64 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | N-[(4-chloro-1-ethylpyrazol-5-yl)methyl]-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | CCn1ncc(Cl)c1CNC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H9ClF7N3O/c1-2-21-6(5(11)3-20-21)4-19-7(22)8(12,13)9(14,15)10(16,17)18/h3H,2,4H2,1H3,(H,19,22) |
| InChIKey | MKMZXKAROMSFJH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.64 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|