C19H19BrClN3O3 — CID 19297574
N-[3-(4-bromopyrazol-1-yl)propyl]-5-[(2-chloro-6-methylphenoxy)methyl]furan-2-carboxamide (PubChem CID 19297574) has the molecular formula C19H19BrClN3O3 and a molecular weight of 452.74 g/mol. Its IUPAC name is N-[3-(4-bromopyrazol-1-yl)propyl]-5-[(2-chloro-6-methylphenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[3-(4-bromopyrazol-1-yl)propyl]-5-[(2-chloro-6-methylphenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19297574 |
| Molecular Formula | C19H19BrClN3O3 |
| Molecular Weight | 452.74 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | N-[3-(4-bromopyrazol-1-yl)propyl]-5-[(2-chloro-6-methylphenoxy)methyl]furan-2-carboxamide |
| SMILES | Cc1cccc(Cl)c1OCc1ccc(C(=O)NCCCn2cc(Br)cn2)o1 |
| InChI | InChI=1S/C19H19BrClN3O3/c1-13-4-2-5-16(21)18(13)26-12-15-6-7-17(27-15)19(25)22-8-3-9-24-11-14(20)10-23-24/h2,4-7,10-11H,3,8-9,12H2,1H3,(H,22,25) |
| InChIKey | SCIVLDFHLCRLMN-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.74 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|