C34H26FN5O5S2 — CID 19303658
N-[(E)-3-[3-[1-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19303658) has the molecular formula C34H26FN5O5S2 and a molecular weight of 667.74 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19303658 |
| Molecular Formula | C34H26FN5O5S2 |
| Molecular Weight | 667.74 g/mol |
| Exact Mass | 667.14 |
| IUPAC Name | N-[(E)-3-[3-[1-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CC(Sc1cccc(NC(=O)/C(=C\c2ccc([N+](=O)[O-])cc2)NC(=O)c2ccccc2)c1)C(=O)Nc1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C34H26FN5O5S2/c1-21(31(41)39-34-38-30(20-46-34)23-12-14-25(35)15-13-23)47-28-9-5-8-26(19-28)36-33(43)29(37-32(42)24-6-3-2-4-7-24)18-22-10-16-27(17-11-22)40(44)45/h2-21H,1H3,(H,36,43)(H,37,42)(H,38,39,41)/b29-18+ |
| InChIKey | DCXYEXVAKINYSJ-RDRPBHBLSA-N |
| XLogP | 7.39 |
| TPSA | 143.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.74 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|