C34H31Cl2N3O4S — CID 19306941
N-[(E)-1-(2,4-dichlorophenyl)-3-[3-[1-(2-ethoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19306941) has the molecular formula C34H31Cl2N3O4S and a molecular weight of 648.61 g/mol. Its IUPAC name is N-[(E)-1-(2,4-dichlorophenyl)-3-[3-[1-(2-ethoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(2,4-dichlorophenyl)-3-[3-[1-(2-ethoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19306941 |
| Molecular Formula | C34H31Cl2N3O4S |
| Molecular Weight | 648.61 g/mol |
| Exact Mass | 647.14 |
| IUPAC Name | N-[(E)-1-(2,4-dichlorophenyl)-3-[3-[1-(2-ethoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCOc1ccccc1NC(=O)C(CC)Sc1cccc(NC(=O)/C(=C\c2ccc(Cl)cc2Cl)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C34H31Cl2N3O4S/c1-3-31(34(42)38-28-15-8-9-16-30(28)43-4-2)44-26-14-10-13-25(21-26)37-33(41)29(19-23-17-18-24(35)20-27(23)36)39-32(40)22-11-6-5-7-12-22/h5-21,31H,3-4H2,1-2H3,(H,37,41)(H,38,42)(H,39,40)/b29-19+ |
| InChIKey | LUPZNURSYFFYML-VUTHCHCSSA-N |
| XLogP | 8.31 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.61 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|