C33H29N3O7S — CID 19308027
4-[[2-[3-[[(E)-2-benzamido-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoic acid (PubChem CID 19308027) has the molecular formula C33H29N3O7S and a molecular weight of 611.68 g/mol. Its IUPAC name is 4-[[2-[3-[[(E)-2-benzamido-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[3-[[(E)-2-benzamido-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 19308027 |
| Molecular Formula | C33H29N3O7S |
| Molecular Weight | 611.68 g/mol |
| Exact Mass | 611.17 |
| IUPAC Name | 4-[[2-[3-[[(E)-2-benzamido-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoic acid |
| SMILES | COc1ccc(OC)c(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SCC(=O)Nc3ccc(C(=O)O)cc3)c2)c1 |
| InChI | InChI=1S/C33H29N3O7S/c1-42-26-15-16-29(43-2)23(17-26)18-28(36-31(38)21-7-4-3-5-8-21)32(39)35-25-9-6-10-27(19-25)44-20-30(37)34-24-13-11-22(12-14-24)33(40)41/h3-19H,20H2,1-2H3,(H,34,37)(H,35,39)(H,36,38)(H,40,41)/b28-18+ |
| InChIKey | NSWCLTYFFVGRCI-MTDXEUNCSA-N |
| XLogP | 5.54 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.68 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|