C33H31N3O5S — CID 19308804
N-[(E)-3-[3-[1-(3-methoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19308804) has the molecular formula C33H31N3O5S and a molecular weight of 581.69 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-(3-methoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-(3-methoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19308804 |
| Molecular Formula | C33H31N3O5S |
| Molecular Weight | 581.69 g/mol |
| Exact Mass | 581.20 |
| IUPAC Name | N-[(E)-3-[3-[1-(3-methoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SC(C)C(=O)Nc3cccc(OC)c3)c2)cc1 |
| InChI | InChI=1S/C33H31N3O5S/c1-22(31(37)34-25-11-7-13-28(20-25)41-3)42-29-14-8-12-26(21-29)35-33(39)30(19-23-15-17-27(40-2)18-16-23)36-32(38)24-9-5-4-6-10-24/h4-22H,1-3H3,(H,34,37)(H,35,39)(H,36,38)/b30-19+ |
| InChIKey | MCVMMZXFMDMOHU-NDZAJKAJSA-N |
| XLogP | 6.23 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.69 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|