C31H26F3N3O4S — CID 19310924
N-[(Z)-1-(furan-2-yl)-3-oxo-3-[3-[1-oxo-1-[2-(trifluoromethyl)anilino]butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19310924) has the molecular formula C31H26F3N3O4S and a molecular weight of 593.63 g/mol. Its IUPAC name is N-[(Z)-1-(furan-2-yl)-3-oxo-3-[3-[1-oxo-1-[2-(trifluoromethyl)anilino]butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(furan-2-yl)-3-oxo-3-[3-[1-oxo-1-[2-(trifluoromethyl)anilino]butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19310924 |
| Molecular Formula | C31H26F3N3O4S |
| Molecular Weight | 593.63 g/mol |
| Exact Mass | 593.16 |
| IUPAC Name | N-[(Z)-1-(furan-2-yl)-3-oxo-3-[3-[1-oxo-1-[2-(trifluoromethyl)anilino]butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C/c2ccco2)NC(=O)c2ccccc2)c1)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C31H26F3N3O4S/c1-2-27(30(40)36-25-16-7-6-15-24(25)31(32,33)34)42-23-14-8-12-21(18-23)35-29(39)26(19-22-13-9-17-41-22)37-28(38)20-10-4-3-5-11-20/h3-19,27H,2H2,1H3,(H,35,39)(H,36,40)(H,37,38)/b26-19- |
| InChIKey | FZHOENRUCTWKLG-XHPQRKPJSA-N |
| XLogP | 7.22 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.63 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|