C34H31N3O5S — CID 19311195
4-[[2-[3-[[(E)-2-benzamido-3-(4-propan-2-ylphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoic acid (PubChem CID 19311195) has the molecular formula C34H31N3O5S and a molecular weight of 593.71 g/mol. Its IUPAC name is 4-[[2-[3-[[(E)-2-benzamido-3-(4-propan-2-ylphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[3-[[(E)-2-benzamido-3-(4-propan-2-ylphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 19311195 |
| Molecular Formula | C34H31N3O5S |
| Molecular Weight | 593.71 g/mol |
| Exact Mass | 593.20 |
| IUPAC Name | 4-[[2-[3-[[(E)-2-benzamido-3-(4-propan-2-ylphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoic acid |
| SMILES | CC(C)c1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SCC(=O)Nc3ccc(C(=O)O)cc3)c2)cc1 |
| InChI | InChI=1S/C34H31N3O5S/c1-22(2)24-13-11-23(12-14-24)19-30(37-32(39)25-7-4-3-5-8-25)33(40)36-28-9-6-10-29(20-28)43-21-31(38)35-27-17-15-26(16-18-27)34(41)42/h3-20,22H,21H2,1-2H3,(H,35,38)(H,36,40)(H,37,39)(H,41,42)/b30-19+ |
| InChIKey | ODBVCEBWNNUIGS-NDZAJKAJSA-N |
| XLogP | 6.65 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.71 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|