C38H33N3O3S — CID 19313899
N-[(Z)-3-[3-[2-(2-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19313899) has the molecular formula C38H33N3O3S and a molecular weight of 611.77 g/mol. Its IUPAC name is N-[(Z)-3-[3-[2-(2-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[2-(2-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19313899 |
| Molecular Formula | C38H33N3O3S |
| Molecular Weight | 611.77 g/mol |
| Exact Mass | 611.22 |
| IUPAC Name | N-[(Z)-3-[3-[2-(2-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2cccc(SC(C(=O)Nc3ccccc3C)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C38H33N3O3S/c1-26-20-22-28(23-21-26)24-34(41-36(42)30-15-7-4-8-16-30)37(43)39-31-17-11-18-32(25-31)45-35(29-13-5-3-6-14-29)38(44)40-33-19-10-9-12-27(33)2/h3-25,35H,1-2H3,(H,39,43)(H,40,44)(H,41,42)/b34-24- |
| InChIKey | WZJPIMIKLYFSGW-BCJTWVECSA-N |
| XLogP | 8.19 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.77 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|