About N-[3-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]phenyl]thiophene-2-carboxamide
N-[3-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]phenyl]thiophene-2-carboxamide (PubChem CID 19318838) has the molecular formula C22H18N2O3S2
and a molecular weight of 422.53 g/mol. Its IUPAC name is N-[3-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]phenyl]thiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-[3-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]phenyl]thiophene-2-carboxamide |
| PubChem CID | 19318838 |
| Molecular Formula | C22H18N2O3S2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | N-[3-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc(SCCCN2C(=O)c3ccccc3C2=O)c1)c1cccs1 |
| InChI | InChI=1S/C22H18N2O3S2/c25-20(19-10-4-12-29-19)23-15-6-3-7-16(14-15)28-13-5-11-24-21(26)17-8-1-2-9-18(17)22(24)27/h1-4,6-10,12,14H,5,11,13H2,(H,23,25) |
| InChIKey | HSVVSMCFPKCHKG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]phenyl]thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]phenyl]thiophene-2-carboxamide?
The IUPAC name of N-[3-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]phenyl]thiophene-2-carboxamide (CID 19318838) is N-[3-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]phenyl]thiophene-2-carboxamide.
What is the SMILES notation for N-[3-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]phenyl]thiophene-2-carboxamide?
The canonical SMILES for N-[3-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]phenyl]thiophene-2-carboxamide is O=C(Nc1cccc(SCCCN2C(=O)c3ccccc3C2=O)c1)c1cccs1.
What is the InChIKey of N-[3-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]phenyl]thiophene-2-carboxamide?
The InChIKey is HSVVSMCFPKCHKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N2O3S2/c25-20(19-10-4-12-29-19)23-15-6-3-7-16(14-15)28-13-5-11-24-21(26)17-8-1-2-9-18(17)22(24)27/h1-4,6-10,12,14H,5,11,13H2,(H,23,25).
What are the key properties of N-[3-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]phenyl]thiophene-2-carboxamide?
N-[3-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]phenyl]thiophene-2-carboxamide has a molecular weight of 422.53 g/mol, XLogP of 4.78, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]phenyl]thiophene-2-carboxamide is sourced from PubChem (CID 19318838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).