C29H25N5O6S — CID 19319240
N-[(E)-3-[3-[1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxopropan-2-yl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19319240) has the molecular formula C29H25N5O6S and a molecular weight of 571.62 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxopropan-2-yl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxopropan-2-yl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19319240 |
| Molecular Formula | C29H25N5O6S |
| Molecular Weight | 571.62 g/mol |
| Exact Mass | 571.15 |
| IUPAC Name | N-[(E)-3-[3-[1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxopropan-2-yl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1cc(NC(=O)C(C)Sc2cccc(NC(=O)/C(=C\c3ccccc3[N+](=O)[O-])NC(=O)c3ccccc3)c2)no1 |
| InChI | InChI=1S/C29H25N5O6S/c1-18-15-26(33-40-18)32-27(35)19(2)41-23-13-8-12-22(17-23)30-29(37)24(31-28(36)20-9-4-3-5-10-20)16-21-11-6-7-14-25(21)34(38)39/h3-17,19H,1-2H3,(H,30,37)(H,31,36)(H,32,33,35)/b24-16+ |
| InChIKey | GAEWWDCLTPWYJH-LFVJCYFKSA-N |
| XLogP | 5.42 |
| TPSA | 156.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.62 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|