C18H26N4OS — CID 19324836
1-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-3-(3-ethoxypropyl)thiourea (PubChem CID 19324836) has the molecular formula C18H26N4OS and a molecular weight of 346.50 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-3-(3-ethoxypropyl)thiourea.
| Compound Name | 1-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-3-(3-ethoxypropyl)thiourea |
|---|---|
| PubChem CID | 19324836 |
| Molecular Formula | C18H26N4OS |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 1-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-3-(3-ethoxypropyl)thiourea |
| SMILES | CCOCCCNC(=S)NCc1c(C)nn(-c2ccccc2)c1C |
| InChI | InChI=1S/C18H26N4OS/c1-4-23-12-8-11-19-18(24)20-13-17-14(2)21-22(15(17)3)16-9-6-5-7-10-16/h5-7,9-10H,4,8,11-13H2,1-3H3,(H2,19,20,24) |
| InChIKey | HTNYVYDOWMASMA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|