C27H30N2O3 — CID 19325642
[4-[(4-methoxyphenoxy)methyl]phenyl]-[4-[(2-methylphenyl)methyl]piperazin-1-yl]methanone (PubChem CID 19325642) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is [4-[(4-methoxyphenoxy)methyl]phenyl]-[4-[(2-methylphenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | [4-[(4-methoxyphenoxy)methyl]phenyl]-[4-[(2-methylphenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 19325642 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | [4-[(4-methoxyphenoxy)methyl]phenyl]-[4-[(2-methylphenyl)methyl]piperazin-1-yl]methanone |
| SMILES | COc1ccc(OCc2ccc(C(=O)N3CCN(Cc4ccccc4C)CC3)cc2)cc1 |
| InChI | InChI=1S/C27H30N2O3/c1-21-5-3-4-6-24(21)19-28-15-17-29(18-16-28)27(30)23-9-7-22(8-10-23)20-32-26-13-11-25(31-2)12-14-26/h3-14H,15-20H2,1-2H3 |
| InChIKey | GRZMQRSKBQXVKA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |