C26H25FN2O2 — CID 19327460
[2-[4-[(2-fluorophenyl)methyl]piperazine-1-carbonyl]phenyl]-(4-methylphenyl)methanone (PubChem CID 19327460) has the molecular formula C26H25FN2O2 and a molecular weight of 416.50 g/mol. Its IUPAC name is [2-[4-[(2-fluorophenyl)methyl]piperazine-1-carbonyl]phenyl]-(4-methylphenyl)methanone.
| Compound Name | [2-[4-[(2-fluorophenyl)methyl]piperazine-1-carbonyl]phenyl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 19327460 |
| Molecular Formula | C26H25FN2O2 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | [2-[4-[(2-fluorophenyl)methyl]piperazine-1-carbonyl]phenyl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)c2ccccc2C(=O)N2CCN(Cc3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C26H25FN2O2/c1-19-10-12-20(13-11-19)25(30)22-7-3-4-8-23(22)26(31)29-16-14-28(15-17-29)18-21-6-2-5-9-24(21)27/h2-13H,14-18H2,1H3 |
| InChIKey | PBZYAXUBNYZIOD-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |