C11H12F7N3O — CID 19328081
2,2,3,3,4,4,4-heptafluoro-N-[3-(4-methylpyrazol-1-yl)propyl]butanamide (PubChem CID 19328081) has the molecular formula C11H12F7N3O and a molecular weight of 335.22 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-[3-(4-methylpyrazol-1-yl)propyl]butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-[3-(4-methylpyrazol-1-yl)propyl]butanamide |
|---|---|
| PubChem CID | 19328081 |
| Molecular Formula | C11H12F7N3O |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-[3-(4-methylpyrazol-1-yl)propyl]butanamide |
| SMILES | Cc1cnn(CCCNC(=O)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H12F7N3O/c1-7-5-20-21(6-7)4-2-3-19-8(22)9(12,13)10(14,15)11(16,17)18/h5-6H,2-4H2,1H3,(H,19,22) |
| InChIKey | DNOTZJPVKJVNKY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|