C15H12F3N5O3 — CID 19328285
5-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole (PubChem CID 19328285) has the molecular formula C15H12F3N5O3 and a molecular weight of 367.29 g/mol. Its IUPAC name is 5-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole.
| Compound Name | 5-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 19328285 |
| Molecular Formula | C15H12F3N5O3 |
| Molecular Weight | 367.29 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 5-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole |
| SMILES | Cc1cc(C(F)(F)F)nn1CCc1nc(-c2ccc([N+](=O)[O-])cc2)no1 |
| InChI | InChI=1S/C15H12F3N5O3/c1-9-8-12(15(16,17)18)20-22(9)7-6-13-19-14(21-26-13)10-2-4-11(5-3-10)23(24)25/h2-5,8H,6-7H2,1H3 |
| InChIKey | PEHRHDFGZRHPRN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 99.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|