C18H17N3O5 — CID 19328687
2-[4-[5-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-3-yl]phenoxy]acetamide (PubChem CID 19328687) has the molecular formula C18H17N3O5 and a molecular weight of 355.35 g/mol. Its IUPAC name is 2-[4-[5-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-3-yl]phenoxy]acetamide.
| Compound Name | 2-[4-[5-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-3-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 19328687 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 2-[4-[5-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-3-yl]phenoxy]acetamide |
| SMILES | COc1ccc(-c2nc(-c3ccc(OCC(N)=O)cc3)no2)cc1OC |
| InChI | InChI=1S/C18H17N3O5/c1-23-14-8-5-12(9-15(14)24-2)18-20-17(21-26-18)11-3-6-13(7-4-11)25-10-16(19)22/h3-9H,10H2,1-2H3,(H2,19,22) |
| InChIKey | GZTIQKSKIZMZPO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 109.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |