C15H19N3O — CID 19329054
N-[(1,5-dimethylpyrazol-3-yl)methyl]-3,4-dimethylbenzamide (PubChem CID 19329054) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is N-[(1,5-dimethylpyrazol-3-yl)methyl]-3,4-dimethylbenzamide.
| Compound Name | N-[(1,5-dimethylpyrazol-3-yl)methyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 19329054 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | N-[(1,5-dimethylpyrazol-3-yl)methyl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NCc2cc(C)n(C)n2)cc1C |
| InChI | InChI=1S/C15H19N3O/c1-10-5-6-13(7-11(10)2)15(19)16-9-14-8-12(3)18(4)17-14/h5-8H,9H2,1-4H3,(H,16,19) |
| InChIKey | ZIKSSOUIZFGDGM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |