C18H17BrClN3O3 — CID 19333135
N-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-5-[(2-chlorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19333135) has the molecular formula C18H17BrClN3O3 and a molecular weight of 438.71 g/mol. Its IUPAC name is N-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-5-[(2-chlorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-5-[(2-chlorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19333135 |
| Molecular Formula | C18H17BrClN3O3 |
| Molecular Weight | 438.71 g/mol |
| Exact Mass | 437.01 |
| IUPAC Name | N-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-5-[(2-chlorophenoxy)methyl]furan-2-carboxamide |
| SMILES | CCn1cc(Br)c(CNC(=O)c2ccc(COc3ccccc3Cl)o2)n1 |
| InChI | InChI=1S/C18H17BrClN3O3/c1-2-23-10-13(19)15(22-23)9-21-18(24)17-8-7-12(26-17)11-25-16-6-4-3-5-14(16)20/h3-8,10H,2,9,11H2,1H3,(H,21,24) |
| InChIKey | ASMRJPSSEIQPBC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.71 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |