About 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3-butylurea
1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3-butylurea (PubChem CID 19334050) has the molecular formula C13H23BrN4O
and a molecular weight of 331.26 g/mol. Its IUPAC name is 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3-butylurea.
Molecular Properties
| Compound Name | 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3-butylurea |
| PubChem CID | 19334050 |
| Molecular Formula | C13H23BrN4O |
| Molecular Weight | 331.26 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3-butylurea |
| SMILES | CCCCNC(=O)NCCCn1nc(C)c(Br)c1C |
| InChI | InChI=1S/C13H23BrN4O/c1-4-5-7-15-13(19)16-8-6-9-18-11(3)12(14)10(2)17-18/h4-9H2,1-3H3,(H2,15,16,19) |
| InChIKey | UWFMNWUQULJSMC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3-butylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3-butylurea?
The IUPAC name of 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3-butylurea (CID 19334050) is 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3-butylurea.
What is the SMILES notation for 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3-butylurea?
The canonical SMILES for 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3-butylurea is CCCCNC(=O)NCCCn1nc(C)c(Br)c1C.
What is the InChIKey of 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3-butylurea?
The InChIKey is UWFMNWUQULJSMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23BrN4O/c1-4-5-7-15-13(19)16-8-6-9-18-11(3)12(14)10(2)17-18/h4-9H2,1-3H3,(H2,15,16,19).
What are the key properties of 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3-butylurea?
1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3-butylurea has a molecular weight of 331.26 g/mol, XLogP of 2.75, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-3-butylurea is sourced from PubChem (CID 19334050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).