C26H24ClN3O2 — CID 19335847
N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-[(3-chlorophenoxy)methyl]benzamide (PubChem CID 19335847) has the molecular formula C26H24ClN3O2 and a molecular weight of 445.95 g/mol. Its IUPAC name is N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-[(3-chlorophenoxy)methyl]benzamide.
| Compound Name | N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-[(3-chlorophenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 19335847 |
| Molecular Formula | C26H24ClN3O2 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-[(3-chlorophenoxy)methyl]benzamide |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1NC(=O)c1ccc(COc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C26H24ClN3O2/c1-18-25(19(2)30(29-18)16-20-7-4-3-5-8-20)28-26(31)22-13-11-21(12-14-22)17-32-24-10-6-9-23(27)15-24/h3-15H,16-17H2,1-2H3,(H,28,31) |
| InChIKey | MGUIIRGUSKTZBL-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |