C14H15F7N4O2 — CID 19338682
2,2,3,3,4,4,4-heptafluoro-N-[1-methyl-5-(piperidine-1-carbonyl)pyrazol-4-yl]butanamide (PubChem CID 19338682) has the molecular formula C14H15F7N4O2 and a molecular weight of 404.29 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-[1-methyl-5-(piperidine-1-carbonyl)pyrazol-4-yl]butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-[1-methyl-5-(piperidine-1-carbonyl)pyrazol-4-yl]butanamide |
|---|---|
| PubChem CID | 19338682 |
| Molecular Formula | C14H15F7N4O2 |
| Molecular Weight | 404.29 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-[1-methyl-5-(piperidine-1-carbonyl)pyrazol-4-yl]butanamide |
| SMILES | Cn1ncc(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)c1C(=O)N1CCCCC1 |
| InChI | InChI=1S/C14H15F7N4O2/c1-24-9(10(26)25-5-3-2-4-6-25)8(7-22-24)23-11(27)12(15,16)13(17,18)14(19,20)21/h7H,2-6H2,1H3,(H,23,27) |
| InChIKey | MGHKEXZATZVNOZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|