C23H14Cl6FN3O3 — CID 19339273
N-[1-[(2-chloro-6-fluorophenyl)methyl]-5-methylpyrazol-3-yl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19339273) has the molecular formula C23H14Cl6FN3O3 and a molecular weight of 612.10 g/mol. Its IUPAC name is N-[1-[(2-chloro-6-fluorophenyl)methyl]-5-methylpyrazol-3-yl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[1-[(2-chloro-6-fluorophenyl)methyl]-5-methylpyrazol-3-yl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19339273 |
| Molecular Formula | C23H14Cl6FN3O3 |
| Molecular Weight | 612.10 g/mol |
| Exact Mass | 608.92 |
| IUPAC Name | N-[1-[(2-chloro-6-fluorophenyl)methyl]-5-methylpyrazol-3-yl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccc(COc3c(Cl)c(Cl)c(Cl)c(Cl)c3Cl)o2)nn1Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C23H14Cl6FN3O3/c1-10-7-16(32-33(10)8-12-13(24)3-2-4-14(12)30)31-23(34)15-6-5-11(36-15)9-35-22-20(28)18(26)17(25)19(27)21(22)29/h2-7H,8-9H2,1H3,(H,31,32,34) |
| InChIKey | UOXIFUYLWVBYQK-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.10 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|