C26H26N4O7 — CID 19341197
N-[1-[(3,4-dimethoxyphenyl)methyl]-3,5-dimethylpyrazol-4-yl]-5-[(4-nitrophenoxy)methyl]furan-2-carboxamide (PubChem CID 19341197) has the molecular formula C26H26N4O7 and a molecular weight of 506.52 g/mol. Its IUPAC name is N-[1-[(3,4-dimethoxyphenyl)methyl]-3,5-dimethylpyrazol-4-yl]-5-[(4-nitrophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[1-[(3,4-dimethoxyphenyl)methyl]-3,5-dimethylpyrazol-4-yl]-5-[(4-nitrophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19341197 |
| Molecular Formula | C26H26N4O7 |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | N-[1-[(3,4-dimethoxyphenyl)methyl]-3,5-dimethylpyrazol-4-yl]-5-[(4-nitrophenoxy)methyl]furan-2-carboxamide |
| SMILES | COc1ccc(Cn2nc(C)c(NC(=O)c3ccc(COc4ccc([N+](=O)[O-])cc4)o3)c2C)cc1OC |
| InChI | InChI=1S/C26H26N4O7/c1-16-25(17(2)29(28-16)14-18-5-11-22(34-3)24(13-18)35-4)27-26(31)23-12-10-21(37-23)15-36-20-8-6-19(7-9-20)30(32)33/h5-13H,14-15H2,1-4H3,(H,27,31) |
| InChIKey | PIEDJGAGRLPKJP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 130.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|