C28H25Cl2N3O3 — CID 19345301
(E)-N-[1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-[4-methoxy-3-[(3-methylphenoxy)methyl]phenyl]prop-2-enamide (PubChem CID 19345301) has the molecular formula C28H25Cl2N3O3 and a molecular weight of 522.43 g/mol. Its IUPAC name is (E)-N-[1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-[4-methoxy-3-[(3-methylphenoxy)methyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-[1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-[4-methoxy-3-[(3-methylphenoxy)methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 19345301 |
| Molecular Formula | C28H25Cl2N3O3 |
| Molecular Weight | 522.43 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | (E)-N-[1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-[4-methoxy-3-[(3-methylphenoxy)methyl]phenyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccn(Cc3ccc(Cl)cc3Cl)n2)cc1COc1cccc(C)c1 |
| InChI | InChI=1S/C28H25Cl2N3O3/c1-19-4-3-5-24(14-19)36-18-22-15-20(6-10-26(22)35-2)7-11-28(34)31-27-12-13-33(32-27)17-21-8-9-23(29)16-25(21)30/h3-16H,17-18H2,1-2H3,(H,31,32,34)/b11-7+ |
| InChIKey | CCGCWOBCCIOJDI-YRNVUSSQSA-N |
| XLogP | 6.79 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.43 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|