C16H15N3O2 — CID 19346357
N-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]furan-2-carboxamide (PubChem CID 19346357) has the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. Its IUPAC name is N-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]furan-2-carboxamide.
| Compound Name | N-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19346357 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]furan-2-carboxamide |
| SMILES | Cc1ccccc1Cn1cc(NC(=O)c2ccco2)cn1 |
| InChI | InChI=1S/C16H15N3O2/c1-12-5-2-3-6-13(12)10-19-11-14(9-17-19)18-16(20)15-7-4-8-21-15/h2-9,11H,10H2,1H3,(H,18,20) |
| InChIKey | LHCXHPNZCKVMOY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |