C15H18ClN3O — CID 19346727
2-chloro-N-[3,5-dimethyl-1-[(3-methylphenyl)methyl]pyrazol-4-yl]acetamide (PubChem CID 19346727) has the molecular formula C15H18ClN3O and a molecular weight of 291.78 g/mol. Its IUPAC name is 2-chloro-N-[3,5-dimethyl-1-[(3-methylphenyl)methyl]pyrazol-4-yl]acetamide.
| Compound Name | 2-chloro-N-[3,5-dimethyl-1-[(3-methylphenyl)methyl]pyrazol-4-yl]acetamide |
|---|---|
| PubChem CID | 19346727 |
| Molecular Formula | C15H18ClN3O |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-chloro-N-[3,5-dimethyl-1-[(3-methylphenyl)methyl]pyrazol-4-yl]acetamide |
| SMILES | Cc1cccc(Cn2nc(C)c(NC(=O)CCl)c2C)c1 |
| InChI | InChI=1S/C15H18ClN3O/c1-10-5-4-6-13(7-10)9-19-12(3)15(11(2)18-19)17-14(20)8-16/h4-7H,8-9H2,1-3H3,(H,17,20) |
| InChIKey | HWMGTDMLFTZOMO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|