C19H16ClFIN3O — CID 19346969
N-[1-[(2-chloro-4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-2-iodobenzamide (PubChem CID 19346969) has the molecular formula C19H16ClFIN3O and a molecular weight of 483.71 g/mol. Its IUPAC name is N-[1-[(2-chloro-4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-2-iodobenzamide.
| Compound Name | N-[1-[(2-chloro-4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-2-iodobenzamide |
|---|---|
| PubChem CID | 19346969 |
| Molecular Formula | C19H16ClFIN3O |
| Molecular Weight | 483.71 g/mol |
| Exact Mass | 483.00 |
| IUPAC Name | N-[1-[(2-chloro-4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-2-iodobenzamide |
| SMILES | Cc1nn(Cc2ccc(F)cc2Cl)c(C)c1NC(=O)c1ccccc1I |
| InChI | InChI=1S/C19H16ClFIN3O/c1-11-18(23-19(26)15-5-3-4-6-17(15)22)12(2)25(24-11)10-13-7-8-14(21)9-16(13)20/h3-9H,10H2,1-2H3,(H,23,26) |
| InChIKey | GDLAVYRJSWQXFH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.71 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|