About 2-(hydroxymethyl)-3,5-dimethyl-1H-pyridin-4-one
2-(hydroxymethyl)-3,5-dimethyl-1H-pyridin-4-one (PubChem CID 19347453) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is 2-(hydroxymethyl)-3,5-dimethyl-1H-pyridin-4-one.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-3,5-dimethyl-1H-pyridin-4-one |
| PubChem CID | 19347453 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 2-(hydroxymethyl)-3,5-dimethyl-1H-pyridin-4-one |
| SMILES | Cc1c[nH]c(CO)c(C)c1=O |
| InChI | InChI=1S/C8H11NO2/c1-5-3-9-7(4-10)6(2)8(5)11/h3,10H,4H2,1-2H3,(H,9,11) |
| InChIKey | QAZJWGGYPDKWMQ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(hydroxymethyl)-3,5-dimethyl-1H-pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-3,5-dimethyl-1H-pyridin-4-one?
The IUPAC name of 2-(hydroxymethyl)-3,5-dimethyl-1H-pyridin-4-one (CID 19347453) is 2-(hydroxymethyl)-3,5-dimethyl-1H-pyridin-4-one.
What is the SMILES notation for 2-(hydroxymethyl)-3,5-dimethyl-1H-pyridin-4-one?
The canonical SMILES for 2-(hydroxymethyl)-3,5-dimethyl-1H-pyridin-4-one is Cc1c[nH]c(CO)c(C)c1=O.
What is the InChIKey of 2-(hydroxymethyl)-3,5-dimethyl-1H-pyridin-4-one?
The InChIKey is QAZJWGGYPDKWMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c1-5-3-9-7(4-10)6(2)8(5)11/h3,10H,4H2,1-2H3,(H,9,11).
What are the key properties of 2-(hydroxymethyl)-3,5-dimethyl-1H-pyridin-4-one?
2-(hydroxymethyl)-3,5-dimethyl-1H-pyridin-4-one has a molecular weight of 153.18 g/mol, XLogP of 0.48, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-3,5-dimethyl-1H-pyridin-4-one is sourced from PubChem (CID 19347453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).