About 2-ethyl-N,N-dimethylcyclopropan-1-amine
2-ethyl-N,N-dimethylcyclopropan-1-amine (PubChem CID 19347525) has the molecular formula C7H15N
and a molecular weight of 113.20 g/mol. Its IUPAC name is 2-ethyl-N,N-dimethylcyclopropan-1-amine.
Molecular Properties
| Compound Name | 2-ethyl-N,N-dimethylcyclopropan-1-amine |
| PubChem CID | 19347525 |
| Molecular Formula | C7H15N |
| Molecular Weight | 113.20 g/mol |
| Exact Mass | 113.12 |
| IUPAC Name | 2-ethyl-N,N-dimethylcyclopropan-1-amine |
| SMILES | CCC1CC1N(C)C |
| InChI | InChI=1S/C7H15N/c1-4-6-5-7(6)8(2)3/h6-7H,4-5H2,1-3H3 |
| InChIKey | VSBKENTXQNAXEG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.20 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-N,N-dimethylcyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N,N-dimethylcyclopropan-1-amine?
The IUPAC name of 2-ethyl-N,N-dimethylcyclopropan-1-amine (CID 19347525) is 2-ethyl-N,N-dimethylcyclopropan-1-amine.
What is the SMILES notation for 2-ethyl-N,N-dimethylcyclopropan-1-amine?
The canonical SMILES for 2-ethyl-N,N-dimethylcyclopropan-1-amine is CCC1CC1N(C)C.
What is the InChIKey of 2-ethyl-N,N-dimethylcyclopropan-1-amine?
The InChIKey is VSBKENTXQNAXEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N/c1-4-6-5-7(6)8(2)3/h6-7H,4-5H2,1-3H3.
What are the key properties of 2-ethyl-N,N-dimethylcyclopropan-1-amine?
2-ethyl-N,N-dimethylcyclopropan-1-amine has a molecular weight of 113.20 g/mol, XLogP of 1.35, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N,N-dimethylcyclopropan-1-amine is sourced from PubChem (CID 19347525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).