About (E)-but-2-enedioate;4,4-dimethylmorpholin-4-ium;hydron
(E)-but-2-enedioate;4,4-dimethylmorpholin-4-ium;hydron (PubChem CID 19347546) has the molecular formula C10H17NO5
and a molecular weight of 231.25 g/mol. Its IUPAC name is (E)-but-2-enedioate;4,4-dimethylmorpholin-4-ium;hydron.
Molecular Properties
| Compound Name | (E)-but-2-enedioate;4,4-dimethylmorpholin-4-ium;hydron |
| PubChem CID | 19347546 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | (E)-but-2-enedioate;4,4-dimethylmorpholin-4-ium;hydron |
| SMILES | C[N+]1(C)CCOCC1.O=C([O-])/C=C/C(=O)[O-].[H+] |
| InChI | InChI=1S/C6H14NO.C4H4O4/c1-7(2)3-5-8-6-4-7;5-3(6)1-2-4(7)8/h3-6H2,1-2H3;1-2H,(H,5,6)(H,7,8)/q+1;/p-1/b;2-1+ |
| InChIKey | VRYPLFJXSSZWFK-WLHGVMLRSA-M |
| XLogP | -2.75 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedioate;4,4-dimethylmorpholin-4-ium;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedioate;4,4-dimethylmorpholin-4-ium;hydron?
The IUPAC name of (E)-but-2-enedioate;4,4-dimethylmorpholin-4-ium;hydron (CID 19347546) is (E)-but-2-enedioate;4,4-dimethylmorpholin-4-ium;hydron.
What is the SMILES notation for (E)-but-2-enedioate;4,4-dimethylmorpholin-4-ium;hydron?
The canonical SMILES for (E)-but-2-enedioate;4,4-dimethylmorpholin-4-ium;hydron is C[N+]1(C)CCOCC1.O=C([O-])/C=C/C(=O)[O-].[H+].
What is the InChIKey of (E)-but-2-enedioate;4,4-dimethylmorpholin-4-ium;hydron?
The InChIKey is VRYPLFJXSSZWFK-WLHGVMLRSA-M. The full InChI is InChI=1S/C6H14NO.C4H4O4/c1-7(2)3-5-8-6-4-7;5-3(6)1-2-4(7)8/h3-6H2,1-2H3;1-2H,(H,5,6)(H,7,8)/q+1;/p-1/b;2-1+.
What are the key properties of (E)-but-2-enedioate;4,4-dimethylmorpholin-4-ium;hydron?
(E)-but-2-enedioate;4,4-dimethylmorpholin-4-ium;hydron has a molecular weight of 231.25 g/mol, XLogP of -2.75, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedioate;4,4-dimethylmorpholin-4-ium;hydron is sourced from PubChem (CID 19347546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).