About [2-(3,4-dichlorophenyl)-2-hydroxyethyl]azanium chloride
[2-(3,4-dichlorophenyl)-2-hydroxyethyl]azanium chloride (PubChem CID 19348) has the molecular formula C8H10Cl3NO
and a molecular weight of 242.53 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)-2-hydroxyethyl]azanium chloride.
Molecular Properties
| Compound Name | [2-(3,4-dichlorophenyl)-2-hydroxyethyl]azanium chloride |
| PubChem CID | 19348 |
| Molecular Formula | C8H10Cl3NO |
| Molecular Weight | 242.53 g/mol |
| Exact Mass | 240.98 |
| IUPAC Name | [2-(3,4-dichlorophenyl)-2-hydroxyethyl]azanium chloride |
| SMILES | [Cl-].[NH3+]CC(O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H9Cl2NO.ClH/c9-6-2-1-5(3-7(6)10)8(12)4-11;/h1-3,8,12H,4,11H2;1H |
| InChIKey | MDSYSOQCKJDTTE-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 47.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.53 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [2-(3,4-dichlorophenyl)-2-hydroxyethyl]azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,4-dichlorophenyl)-2-hydroxyethyl]azanium chloride?
The IUPAC name of [2-(3,4-dichlorophenyl)-2-hydroxyethyl]azanium chloride (CID 19348) is [2-(3,4-dichlorophenyl)-2-hydroxyethyl]azanium chloride.
What is the SMILES notation for [2-(3,4-dichlorophenyl)-2-hydroxyethyl]azanium chloride?
The canonical SMILES for [2-(3,4-dichlorophenyl)-2-hydroxyethyl]azanium chloride is [Cl-].[NH3+]CC(O)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of [2-(3,4-dichlorophenyl)-2-hydroxyethyl]azanium chloride?
The InChIKey is MDSYSOQCKJDTTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9Cl2NO.ClH/c9-6-2-1-5(3-7(6)10)8(12)4-11;/h1-3,8,12H,4,11H2;1H.
What are the key properties of [2-(3,4-dichlorophenyl)-2-hydroxyethyl]azanium chloride?
[2-(3,4-dichlorophenyl)-2-hydroxyethyl]azanium chloride has a molecular weight of 242.53 g/mol, XLogP of -1.73, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,4-dichlorophenyl)-2-hydroxyethyl]azanium chloride is sourced from PubChem (CID 19348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).