C15H23ClSi — CID 19348914
2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl-chloro-dimethylsilane (PubChem CID 19348914) has the molecular formula C15H23ClSi and a molecular weight of 266.89 g/mol. Its IUPAC name is 2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl-chloro-dimethylsilane.
| Compound Name | 2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl-chloro-dimethylsilane |
|---|---|
| PubChem CID | 19348914 |
| Molecular Formula | C15H23ClSi |
| Molecular Weight | 266.89 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl-chloro-dimethylsilane |
| SMILES | C[Si](C)(Cl)C1C2C=CC=CC2C2CCCCC21 |
| InChI | InChI=1S/C15H23ClSi/c1-17(2,16)15-13-9-5-3-7-11(13)12-8-4-6-10-14(12)15/h3,5,7,9,11-15H,4,6,8,10H2,1-2H3 |
| InChIKey | IMWXSZXQORAMJF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.89 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|