About 2-[[2,4-bis-(4-methylphenyl)sulfonylphenoxy]methyl]oxirane
2-[[2,4-bis-(4-methylphenyl)sulfonylphenoxy]methyl]oxirane (PubChem CID 19349206) has the molecular formula C23H22O6S2
and a molecular weight of 458.56 g/mol. Its IUPAC name is 2-[[2,4-bis-(4-methylphenyl)sulfonylphenoxy]methyl]oxirane.
Molecular Properties
| Compound Name | 2-[[2,4-bis-(4-methylphenyl)sulfonylphenoxy]methyl]oxirane |
| PubChem CID | 19349206 |
| Molecular Formula | C23H22O6S2 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | 2-[[2,4-bis-(4-methylphenyl)sulfonylphenoxy]methyl]oxirane |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(OCC3CO3)c(S(=O)(=O)c3ccc(C)cc3)c2)cc1 |
| InChI | InChI=1S/C23H22O6S2/c1-16-3-7-19(8-4-16)30(24,25)21-11-12-22(29-15-18-14-28-18)23(13-21)31(26,27)20-9-5-17(2)6-10-20/h3-13,18H,14-15H2,1-2H3 |
| InChIKey | MOZFTPVQKBNSHI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 90.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2,4-bis-(4-methylphenyl)sulfonylphenoxy]methyl]oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2,4-bis-(4-methylphenyl)sulfonylphenoxy]methyl]oxirane?
The IUPAC name of 2-[[2,4-bis-(4-methylphenyl)sulfonylphenoxy]methyl]oxirane (CID 19349206) is 2-[[2,4-bis-(4-methylphenyl)sulfonylphenoxy]methyl]oxirane.
What is the SMILES notation for 2-[[2,4-bis-(4-methylphenyl)sulfonylphenoxy]methyl]oxirane?
The canonical SMILES for 2-[[2,4-bis-(4-methylphenyl)sulfonylphenoxy]methyl]oxirane is Cc1ccc(S(=O)(=O)c2ccc(OCC3CO3)c(S(=O)(=O)c3ccc(C)cc3)c2)cc1.
What is the InChIKey of 2-[[2,4-bis-(4-methylphenyl)sulfonylphenoxy]methyl]oxirane?
The InChIKey is MOZFTPVQKBNSHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22O6S2/c1-16-3-7-19(8-4-16)30(24,25)21-11-12-22(29-15-18-14-28-18)23(13-21)31(26,27)20-9-5-17(2)6-10-20/h3-13,18H,14-15H2,1-2H3.
What are the key properties of 2-[[2,4-bis-(4-methylphenyl)sulfonylphenoxy]methyl]oxirane?
2-[[2,4-bis-(4-methylphenyl)sulfonylphenoxy]methyl]oxirane has a molecular weight of 458.56 g/mol, XLogP of 3.75, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2,4-bis-(4-methylphenyl)sulfonylphenoxy]methyl]oxirane is sourced from PubChem (CID 19349206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).