About 3,5-dihexyl-1,4-oxathiane
3,5-dihexyl-1,4-oxathiane (PubChem CID 19349490) has the molecular formula C16H32OS
and a molecular weight of 272.50 g/mol. Its IUPAC name is 3,5-dihexyl-1,4-oxathiane.
Molecular Properties
| Compound Name | 3,5-dihexyl-1,4-oxathiane |
| PubChem CID | 19349490 |
| Molecular Formula | C16H32OS |
| Molecular Weight | 272.50 g/mol |
| Exact Mass | 272.22 |
| IUPAC Name | 3,5-dihexyl-1,4-oxathiane |
| SMILES | CCCCCCC1COCC(CCCCCC)S1 |
| InChI | InChI=1S/C16H32OS/c1-3-5-7-9-11-15-13-17-14-16(18-15)12-10-8-6-4-2/h15-16H,3-14H2,1-2H3 |
| InChIKey | CKYYFFNNBXDCQD-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dihexyl-1,4-oxathiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dihexyl-1,4-oxathiane?
The IUPAC name of 3,5-dihexyl-1,4-oxathiane (CID 19349490) is 3,5-dihexyl-1,4-oxathiane.
What is the SMILES notation for 3,5-dihexyl-1,4-oxathiane?
The canonical SMILES for 3,5-dihexyl-1,4-oxathiane is CCCCCCC1COCC(CCCCCC)S1.
What is the InChIKey of 3,5-dihexyl-1,4-oxathiane?
The InChIKey is CKYYFFNNBXDCQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32OS/c1-3-5-7-9-11-15-13-17-14-16(18-15)12-10-8-6-4-2/h15-16H,3-14H2,1-2H3.
What are the key properties of 3,5-dihexyl-1,4-oxathiane?
3,5-dihexyl-1,4-oxathiane has a molecular weight of 272.50 g/mol, XLogP of 5.43, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dihexyl-1,4-oxathiane is sourced from PubChem (CID 19349490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).