About 2-cyano-N,N-bis(2-hydroxypropyl)acetamide
2-cyano-N,N-bis(2-hydroxypropyl)acetamide (PubChem CID 19350105) has the molecular formula C9H16N2O3
and a molecular weight of 200.24 g/mol. Its IUPAC name is 2-cyano-N,N-bis(2-hydroxypropyl)acetamide.
Molecular Properties
| Compound Name | 2-cyano-N,N-bis(2-hydroxypropyl)acetamide |
| PubChem CID | 19350105 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 2-cyano-N,N-bis(2-hydroxypropyl)acetamide |
| SMILES | CC(O)CN(CC(C)O)C(=O)CC#N |
| InChI | InChI=1S/C9H16N2O3/c1-7(12)5-11(6-8(2)13)9(14)3-4-10/h7-8,12-13H,3,5-6H2,1-2H3 |
| InChIKey | KJRXXEAASZWALT-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyano-N,N-bis(2-hydroxypropyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N,N-bis(2-hydroxypropyl)acetamide?
The IUPAC name of 2-cyano-N,N-bis(2-hydroxypropyl)acetamide (CID 19350105) is 2-cyano-N,N-bis(2-hydroxypropyl)acetamide.
What is the SMILES notation for 2-cyano-N,N-bis(2-hydroxypropyl)acetamide?
The canonical SMILES for 2-cyano-N,N-bis(2-hydroxypropyl)acetamide is CC(O)CN(CC(C)O)C(=O)CC#N.
What is the InChIKey of 2-cyano-N,N-bis(2-hydroxypropyl)acetamide?
The InChIKey is KJRXXEAASZWALT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O3/c1-7(12)5-11(6-8(2)13)9(14)3-4-10/h7-8,12-13H,3,5-6H2,1-2H3.
What are the key properties of 2-cyano-N,N-bis(2-hydroxypropyl)acetamide?
2-cyano-N,N-bis(2-hydroxypropyl)acetamide has a molecular weight of 200.24 g/mol, XLogP of -0.51, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N,N-bis(2-hydroxypropyl)acetamide is sourced from PubChem (CID 19350105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).