About 1-methyl-3,8a-dihydro-2H-tetrazolo[1,5-a]pyridin-8-ol
1-methyl-3,8a-dihydro-2H-tetrazolo[1,5-a]pyridin-8-ol (PubChem CID 19350370) has the molecular formula C6H10N4O
and a molecular weight of 154.17 g/mol. Its IUPAC name is 1-methyl-3,8a-dihydro-2H-tetrazolo[1,5-a]pyridin-8-ol.
Molecular Properties
| Compound Name | 1-methyl-3,8a-dihydro-2H-tetrazolo[1,5-a]pyridin-8-ol |
| PubChem CID | 19350370 |
| Molecular Formula | C6H10N4O |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | 1-methyl-3,8a-dihydro-2H-tetrazolo[1,5-a]pyridin-8-ol |
| SMILES | CN1NNN2C=CC=C(O)C12 |
| InChI | InChI=1S/C6H10N4O/c1-9-6-5(11)3-2-4-10(6)8-7-9/h2-4,6-8,11H,1H3 |
| InChIKey | WMRQSGRHSGHLFH-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 50.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methyl-3,8a-dihydro-2H-tetrazolo[1,5-a]pyridin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3,8a-dihydro-2H-tetrazolo[1,5-a]pyridin-8-ol?
The IUPAC name of 1-methyl-3,8a-dihydro-2H-tetrazolo[1,5-a]pyridin-8-ol (CID 19350370) is 1-methyl-3,8a-dihydro-2H-tetrazolo[1,5-a]pyridin-8-ol.
What is the SMILES notation for 1-methyl-3,8a-dihydro-2H-tetrazolo[1,5-a]pyridin-8-ol?
The canonical SMILES for 1-methyl-3,8a-dihydro-2H-tetrazolo[1,5-a]pyridin-8-ol is CN1NNN2C=CC=C(O)C12.
What is the InChIKey of 1-methyl-3,8a-dihydro-2H-tetrazolo[1,5-a]pyridin-8-ol?
The InChIKey is WMRQSGRHSGHLFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O/c1-9-6-5(11)3-2-4-10(6)8-7-9/h2-4,6-8,11H,1H3.
What are the key properties of 1-methyl-3,8a-dihydro-2H-tetrazolo[1,5-a]pyridin-8-ol?
1-methyl-3,8a-dihydro-2H-tetrazolo[1,5-a]pyridin-8-ol has a molecular weight of 154.17 g/mol, XLogP of -0.55, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3,8a-dihydro-2H-tetrazolo[1,5-a]pyridin-8-ol is sourced from PubChem (CID 19350370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).