C12H3F15O9S3 — CID 19350389
[2,3-bis(1,1,2,2,2-pentafluoroethylsulfonyloxy)phenyl] 1,1,2,2,2-pentafluoroethanesulfonate (PubChem CID 19350389) has the molecular formula C12H3F15O9S3 and a molecular weight of 672.32 g/mol. Its IUPAC name is [2,3-bis(1,1,2,2,2-pentafluoroethylsulfonyloxy)phenyl] 1,1,2,2,2-pentafluoroethanesulfonate.
| Compound Name | [2,3-bis(1,1,2,2,2-pentafluoroethylsulfonyloxy)phenyl] 1,1,2,2,2-pentafluoroethanesulfonate |
|---|---|
| PubChem CID | 19350389 |
| Molecular Formula | C12H3F15O9S3 |
| Molecular Weight | 672.32 g/mol |
| Exact Mass | 671.87 |
| IUPAC Name | [2,3-bis(1,1,2,2,2-pentafluoroethylsulfonyloxy)phenyl] 1,1,2,2,2-pentafluoroethanesulfonate |
| SMILES | O=S(=O)(Oc1cccc(OS(=O)(=O)C(F)(F)C(F)(F)F)c1OS(=O)(=O)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H3F15O9S3/c13-7(14,15)10(22,23)37(28,29)34-4-2-1-3-5(35-38(30,31)11(24,25)8(16,17)18)6(4)36-39(32,33)12(26,27)9(19,20)21/h1-3H |
| InChIKey | RPFJJDOFAJHWOZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.32 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|