About 1-amino-3,4-dimethylimidazol-2-one
1-amino-3,4-dimethylimidazol-2-one (PubChem CID 19350729) has the molecular formula C5H9N3O
and a molecular weight of 127.15 g/mol. Its IUPAC name is 1-amino-3,4-dimethylimidazol-2-one.
Molecular Properties
| Compound Name | 1-amino-3,4-dimethylimidazol-2-one |
| PubChem CID | 19350729 |
| Molecular Formula | C5H9N3O |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.07 |
| IUPAC Name | 1-amino-3,4-dimethylimidazol-2-one |
| SMILES | Cc1cn(N)c(=O)n1C |
| InChI | InChI=1S/C5H9N3O/c1-4-3-8(6)5(9)7(4)2/h3H,6H2,1-2H3 |
| InChIKey | ABSQEIJAQYRRHP-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-amino-3,4-dimethylimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3,4-dimethylimidazol-2-one?
The IUPAC name of 1-amino-3,4-dimethylimidazol-2-one (CID 19350729) is 1-amino-3,4-dimethylimidazol-2-one.
What is the SMILES notation for 1-amino-3,4-dimethylimidazol-2-one?
The canonical SMILES for 1-amino-3,4-dimethylimidazol-2-one is Cc1cn(N)c(=O)n1C.
What is the InChIKey of 1-amino-3,4-dimethylimidazol-2-one?
The InChIKey is ABSQEIJAQYRRHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O/c1-4-3-8(6)5(9)7(4)2/h3H,6H2,1-2H3.
What are the key properties of 1-amino-3,4-dimethylimidazol-2-one?
1-amino-3,4-dimethylimidazol-2-one has a molecular weight of 127.15 g/mol, XLogP of -0.79, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3,4-dimethylimidazol-2-one is sourced from PubChem (CID 19350729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).