About 2-[3,4-dimethyl-4-(methylamino)-2-oxoimidazolidin-1-yl]acetamide
2-[3,4-dimethyl-4-(methylamino)-2-oxoimidazolidin-1-yl]acetamide (PubChem CID 19350742) has the molecular formula C8H16N4O2
and a molecular weight of 200.24 g/mol. Its IUPAC name is 2-[3,4-dimethyl-4-(methylamino)-2-oxoimidazolidin-1-yl]acetamide.
Molecular Properties
| Compound Name | 2-[3,4-dimethyl-4-(methylamino)-2-oxoimidazolidin-1-yl]acetamide |
| PubChem CID | 19350742 |
| Molecular Formula | C8H16N4O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2-[3,4-dimethyl-4-(methylamino)-2-oxoimidazolidin-1-yl]acetamide |
| SMILES | CNC1(C)CN(CC(N)=O)C(=O)N1C |
| InChI | InChI=1S/C8H16N4O2/c1-8(10-2)5-12(4-6(9)13)7(14)11(8)3/h10H,4-5H2,1-3H3,(H2,9,13) |
| InChIKey | HDROIAAKQINHEO-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[3,4-dimethyl-4-(methylamino)-2-oxoimidazolidin-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,4-dimethyl-4-(methylamino)-2-oxoimidazolidin-1-yl]acetamide?
The IUPAC name of 2-[3,4-dimethyl-4-(methylamino)-2-oxoimidazolidin-1-yl]acetamide (CID 19350742) is 2-[3,4-dimethyl-4-(methylamino)-2-oxoimidazolidin-1-yl]acetamide.
What is the SMILES notation for 2-[3,4-dimethyl-4-(methylamino)-2-oxoimidazolidin-1-yl]acetamide?
The canonical SMILES for 2-[3,4-dimethyl-4-(methylamino)-2-oxoimidazolidin-1-yl]acetamide is CNC1(C)CN(CC(N)=O)C(=O)N1C.
What is the InChIKey of 2-[3,4-dimethyl-4-(methylamino)-2-oxoimidazolidin-1-yl]acetamide?
The InChIKey is HDROIAAKQINHEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4O2/c1-8(10-2)5-12(4-6(9)13)7(14)11(8)3/h10H,4-5H2,1-3H3,(H2,9,13).
What are the key properties of 2-[3,4-dimethyl-4-(methylamino)-2-oxoimidazolidin-1-yl]acetamide?
2-[3,4-dimethyl-4-(methylamino)-2-oxoimidazolidin-1-yl]acetamide has a molecular weight of 200.24 g/mol, XLogP of -1.23, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,4-dimethyl-4-(methylamino)-2-oxoimidazolidin-1-yl]acetamide is sourced from PubChem (CID 19350742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).