About 2-(3,4-dimethyl-2-oxoimidazol-1-yl)acetamide
2-(3,4-dimethyl-2-oxoimidazol-1-yl)acetamide (PubChem CID 19350750) has the molecular formula C7H11N3O2
and a molecular weight of 169.18 g/mol. Its IUPAC name is 2-(3,4-dimethyl-2-oxoimidazol-1-yl)acetamide.
Molecular Properties
| Compound Name | 2-(3,4-dimethyl-2-oxoimidazol-1-yl)acetamide |
| PubChem CID | 19350750 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 2-(3,4-dimethyl-2-oxoimidazol-1-yl)acetamide |
| SMILES | Cc1cn(CC(N)=O)c(=O)n1C |
| InChI | InChI=1S/C7H11N3O2/c1-5-3-10(4-6(8)11)7(12)9(5)2/h3H,4H2,1-2H3,(H2,8,11) |
| InChIKey | QLRAVRORIRYEJY-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3,4-dimethyl-2-oxoimidazol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethyl-2-oxoimidazol-1-yl)acetamide?
The IUPAC name of 2-(3,4-dimethyl-2-oxoimidazol-1-yl)acetamide (CID 19350750) is 2-(3,4-dimethyl-2-oxoimidazol-1-yl)acetamide.
What is the SMILES notation for 2-(3,4-dimethyl-2-oxoimidazol-1-yl)acetamide?
The canonical SMILES for 2-(3,4-dimethyl-2-oxoimidazol-1-yl)acetamide is Cc1cn(CC(N)=O)c(=O)n1C.
What is the InChIKey of 2-(3,4-dimethyl-2-oxoimidazol-1-yl)acetamide?
The InChIKey is QLRAVRORIRYEJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2/c1-5-3-10(4-6(8)11)7(12)9(5)2/h3H,4H2,1-2H3,(H2,8,11).
What are the key properties of 2-(3,4-dimethyl-2-oxoimidazol-1-yl)acetamide?
2-(3,4-dimethyl-2-oxoimidazol-1-yl)acetamide has a molecular weight of 169.18 g/mol, XLogP of -1.02, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethyl-2-oxoimidazol-1-yl)acetamide is sourced from PubChem (CID 19350750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).