About 1,3-dichloro-5-(2,2-dimethoxyethylsulfanyl)benzene
1,3-dichloro-5-(2,2-dimethoxyethylsulfanyl)benzene (PubChem CID 19350985) has the molecular formula C10H12Cl2O2S
and a molecular weight of 267.18 g/mol. Its IUPAC name is 1,3-dichloro-5-(2,2-dimethoxyethylsulfanyl)benzene.
Molecular Properties
| Compound Name | 1,3-dichloro-5-(2,2-dimethoxyethylsulfanyl)benzene |
| PubChem CID | 19350985 |
| Molecular Formula | C10H12Cl2O2S |
| Molecular Weight | 267.18 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | 1,3-dichloro-5-(2,2-dimethoxyethylsulfanyl)benzene |
| SMILES | COC(CSc1cc(Cl)cc(Cl)c1)OC |
| InChI | InChI=1S/C10H12Cl2O2S/c1-13-10(14-2)6-15-9-4-7(11)3-8(12)5-9/h3-5,10H,6H2,1-2H3 |
| InChIKey | WRFUAQYDLZOKPE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.18 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dichloro-5-(2,2-dimethoxyethylsulfanyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dichloro-5-(2,2-dimethoxyethylsulfanyl)benzene?
The IUPAC name of 1,3-dichloro-5-(2,2-dimethoxyethylsulfanyl)benzene (CID 19350985) is 1,3-dichloro-5-(2,2-dimethoxyethylsulfanyl)benzene.
What is the SMILES notation for 1,3-dichloro-5-(2,2-dimethoxyethylsulfanyl)benzene?
The canonical SMILES for 1,3-dichloro-5-(2,2-dimethoxyethylsulfanyl)benzene is COC(CSc1cc(Cl)cc(Cl)c1)OC.
What is the InChIKey of 1,3-dichloro-5-(2,2-dimethoxyethylsulfanyl)benzene?
The InChIKey is WRFUAQYDLZOKPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12Cl2O2S/c1-13-10(14-2)6-15-9-4-7(11)3-8(12)5-9/h3-5,10H,6H2,1-2H3.
What are the key properties of 1,3-dichloro-5-(2,2-dimethoxyethylsulfanyl)benzene?
1,3-dichloro-5-(2,2-dimethoxyethylsulfanyl)benzene has a molecular weight of 267.18 g/mol, XLogP of 3.70, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dichloro-5-(2,2-dimethoxyethylsulfanyl)benzene is sourced from PubChem (CID 19350985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).